C10H14N2O2S — CID 47331342
N-(cyclobutylmethyl)pyridine-3-sulfonamide (PubChem CID 47331342) has the molecular formula C10H14N2O2S and a molecular weight of 226.30 g/mol. Its IUPAC name is N-(cyclobutylmethyl)pyridine-3-sulfonamide.
| Compound Name | N-(cyclobutylmethyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 47331342 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | N-(cyclobutylmethyl)pyridine-3-sulfonamide |
| SMILES | O=S(=O)(NCC1CCC1)c1cccnc1 |
| InChI | InChI=1S/C10H14N2O2S/c13-15(14,10-5-2-6-11-8-10)12-7-9-3-1-4-9/h2,5-6,8-9,12H,1,3-4,7H2 |
| InChIKey | QJSKVEPPMSMHHX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |