C12H20ClN3O2S — CID 119979495
N-(2-piperidin-3-ylethyl)pyridine-3-sulfonamide;hydrochloride (PubChem CID 119979495) has the molecular formula C12H20ClN3O2S and a molecular weight of 305.83 g/mol. Its IUPAC name is N-(2-piperidin-3-ylethyl)pyridine-3-sulfonamide;hydrochloride.
| Compound Name | N-(2-piperidin-3-ylethyl)pyridine-3-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 119979495 |
| Molecular Formula | C12H20ClN3O2S |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | N-(2-piperidin-3-ylethyl)pyridine-3-sulfonamide;hydrochloride |
| SMILES | Cl.O=S(=O)(NCCC1CCCNC1)c1cccnc1 |
| InChI | InChI=1S/C12H19N3O2S.ClH/c16-18(17,12-4-2-7-14-10-12)15-8-5-11-3-1-6-13-9-11;/h2,4,7,10-11,13,15H,1,3,5-6,8-9H2;1H |
| InChIKey | ATYSLZXPLVICHR-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |