C14H18N4O2S2 — CID 71859525
N-[5-(cyclohexylmethyl)-1,3,4-thiadiazol-2-yl]pyridine-3-sulfonamide (PubChem CID 71859525) has the molecular formula C14H18N4O2S2 and a molecular weight of 338.46 g/mol. Its IUPAC name is N-[5-(cyclohexylmethyl)-1,3,4-thiadiazol-2-yl]pyridine-3-sulfonamide.
| Compound Name | N-[5-(cyclohexylmethyl)-1,3,4-thiadiazol-2-yl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 71859525 |
| Molecular Formula | C14H18N4O2S2 |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-[5-(cyclohexylmethyl)-1,3,4-thiadiazol-2-yl]pyridine-3-sulfonamide |
| SMILES | O=S(=O)(Nc1nnc(CC2CCCCC2)s1)c1cccnc1 |
| InChI | InChI=1S/C14H18N4O2S2/c19-22(20,12-7-4-8-15-10-12)18-14-17-16-13(21-14)9-11-5-2-1-3-6-11/h4,7-8,10-11H,1-3,5-6,9H2,(H,17,18) |
| InChIKey | DFHJXGHJISZZOL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |