C17H23N3O2S2 — CID 35539079
4-cyclohexyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide (PubChem CID 35539079) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 4-cyclohexyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 35539079 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 4-cyclohexyl-N-(5-propyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
| SMILES | CCCc1nnc(NS(=O)(=O)c2ccc(C3CCCCC3)cc2)s1 |
| InChI | InChI=1S/C17H23N3O2S2/c1-2-6-16-18-19-17(23-16)20-24(21,22)15-11-9-14(10-12-15)13-7-4-3-5-8-13/h9-13H,2-8H2,1H3,(H,19,20) |
| InChIKey | NPNJUOUKVYZDPR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |