C9H10N4O4S3 — CID 63944661
4-methyl-2-(pyridin-3-ylsulfonylamino)-1,3-thiazole-5-sulfonamide (PubChem CID 63944661) has the molecular formula C9H10N4O4S3 and a molecular weight of 334.40 g/mol. Its IUPAC name is 4-methyl-2-(pyridin-3-ylsulfonylamino)-1,3-thiazole-5-sulfonamide.
| Compound Name | 4-methyl-2-(pyridin-3-ylsulfonylamino)-1,3-thiazole-5-sulfonamide |
|---|---|
| PubChem CID | 63944661 |
| Molecular Formula | C9H10N4O4S3 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 333.99 |
| IUPAC Name | 4-methyl-2-(pyridin-3-ylsulfonylamino)-1,3-thiazole-5-sulfonamide |
| SMILES | Cc1nc(NS(=O)(=O)c2cccnc2)sc1S(N)(=O)=O |
| InChI | InChI=1S/C9H10N4O4S3/c1-6-8(19(10,14)15)18-9(12-6)13-20(16,17)7-3-2-4-11-5-7/h2-5H,1H3,(H,12,13)(H2,10,14,15) |
| InChIKey | LWTCIWAFBQBPTF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 132.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |