C12H13N3O4S2 — CID 61131422
N-(4-methyl-3-sulfamoylphenyl)pyridine-3-sulfonamide (PubChem CID 61131422) has the molecular formula C12H13N3O4S2 and a molecular weight of 327.39 g/mol. Its IUPAC name is N-(4-methyl-3-sulfamoylphenyl)pyridine-3-sulfonamide.
| Compound Name | N-(4-methyl-3-sulfamoylphenyl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 61131422 |
| Molecular Formula | C12H13N3O4S2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | N-(4-methyl-3-sulfamoylphenyl)pyridine-3-sulfonamide |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccnc2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C12H13N3O4S2/c1-9-4-5-10(7-12(9)20(13,16)17)15-21(18,19)11-3-2-6-14-8-11/h2-8,15H,1H3,(H2,13,16,17) |
| InChIKey | SPHGSZYMHAPSPL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |