C14H17N3O6S3 — CID 18286970
4-N-[4-methyl-3-(methylsulfamoyl)phenyl]benzene-1,4-disulfonamide (PubChem CID 18286970) has the molecular formula C14H17N3O6S3 and a molecular weight of 419.51 g/mol. Its IUPAC name is 4-N-[4-methyl-3-(methylsulfamoyl)phenyl]benzene-1,4-disulfonamide.
| Compound Name | 4-N-[4-methyl-3-(methylsulfamoyl)phenyl]benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 18286970 |
| Molecular Formula | C14H17N3O6S3 |
| Molecular Weight | 419.51 g/mol |
| Exact Mass | 419.03 |
| IUPAC Name | 4-N-[4-methyl-3-(methylsulfamoyl)phenyl]benzene-1,4-disulfonamide |
| SMILES | CNS(=O)(=O)c1cc(NS(=O)(=O)c2ccc(S(N)(=O)=O)cc2)ccc1C |
| InChI | InChI=1S/C14H17N3O6S3/c1-10-3-4-11(9-14(10)26(22,23)16-2)17-25(20,21)13-7-5-12(6-8-13)24(15,18)19/h3-9,16-17H,1-2H3,(H2,15,18,19) |
| InChIKey | CNXTVOYWEYMXFE-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.51 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |