C9H13ClN2O4S2 — CID 63664896
5-(chloromethylsulfonylamino)-N,2-dimethylbenzenesulfonamide (PubChem CID 63664896) has the molecular formula C9H13ClN2O4S2 and a molecular weight of 312.80 g/mol. Its IUPAC name is 5-(chloromethylsulfonylamino)-N,2-dimethylbenzenesulfonamide.
| Compound Name | 5-(chloromethylsulfonylamino)-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 63664896 |
| Molecular Formula | C9H13ClN2O4S2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 5-(chloromethylsulfonylamino)-N,2-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(NS(=O)(=O)CCl)ccc1C |
| InChI | InChI=1S/C9H13ClN2O4S2/c1-7-3-4-8(12-17(13,14)6-10)5-9(7)18(15,16)11-2/h3-5,11-12H,6H2,1-2H3 |
| InChIKey | KQXHMZGDKHSKCH-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|