C14H15FN2O4S2 — CID 8519696
5-[(2-fluorophenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide (PubChem CID 8519696) has the molecular formula C14H15FN2O4S2 and a molecular weight of 358.42 g/mol. Its IUPAC name is 5-[(2-fluorophenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide.
| Compound Name | 5-[(2-fluorophenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8519696 |
| Molecular Formula | C14H15FN2O4S2 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.05 |
| IUPAC Name | 5-[(2-fluorophenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(NS(=O)(=O)c2ccccc2F)ccc1C |
| InChI | InChI=1S/C14H15FN2O4S2/c1-10-7-8-11(9-14(10)22(18,19)16-2)17-23(20,21)13-6-4-3-5-12(13)15/h3-9,16-17H,1-2H3 |
| InChIKey | MEDXBBRHWHLQDG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |