C16H20N2O4S2 — CID 8519772
5-[(4-ethylphenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide (PubChem CID 8519772) has the molecular formula C16H20N2O4S2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 5-[(4-ethylphenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide.
| Compound Name | 5-[(4-ethylphenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8519772 |
| Molecular Formula | C16H20N2O4S2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | 5-[(4-ethylphenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide |
| SMILES | CCc1ccc(S(=O)(=O)Nc2ccc(C)c(S(=O)(=O)NC)c2)cc1 |
| InChI | InChI=1S/C16H20N2O4S2/c1-4-13-6-9-15(10-7-13)23(19,20)18-14-8-5-12(2)16(11-14)24(21,22)17-3/h5-11,17-18H,4H2,1-3H3 |
| InChIKey | CSVZCIGHDQKAOJ-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |