C20H26N2O4S2 — CID 8519759
5-[(4-cyclohexylphenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide (PubChem CID 8519759) has the molecular formula C20H26N2O4S2 and a molecular weight of 422.57 g/mol. Its IUPAC name is 5-[(4-cyclohexylphenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide.
| Compound Name | 5-[(4-cyclohexylphenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 8519759 |
| Molecular Formula | C20H26N2O4S2 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 5-[(4-cyclohexylphenyl)sulfonylamino]-N,2-dimethylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1cc(NS(=O)(=O)c2ccc(C3CCCCC3)cc2)ccc1C |
| InChI | InChI=1S/C20H26N2O4S2/c1-15-8-11-18(14-20(15)28(25,26)21-2)22-27(23,24)19-12-9-17(10-13-19)16-6-4-3-5-7-16/h8-14,16,21-22H,3-7H2,1-2H3 |
| InChIKey | UREGFMHZOWTBJW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |