C19H23NO3S2 — CID 95781125
4-cyclohexyl-N-[4-[(R)-methylsulfinyl]phenyl]benzenesulfonamide (PubChem CID 95781125) has the molecular formula C19H23NO3S2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 4-cyclohexyl-N-[4-[(R)-methylsulfinyl]phenyl]benzenesulfonamide.
| Compound Name | 4-cyclohexyl-N-[4-[(R)-methylsulfinyl]phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 95781125 |
| Molecular Formula | C19H23NO3S2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | 4-cyclohexyl-N-[4-[(R)-methylsulfinyl]phenyl]benzenesulfonamide |
| SMILES | C[S@@](=O)c1ccc(NS(=O)(=O)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C19H23NO3S2/c1-24(21)18-11-9-17(10-12-18)20-25(22,23)19-13-7-16(8-14-19)15-5-3-2-4-6-15/h7-15,20H,2-6H2,1H3/t24-/m1/s1 |
| InChIKey | HWYVBKJYXBRLPL-XMMPIXPASA-N |
| XLogP | 4.27 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |