C22H27NO4S — CID 7938910
propan-2-yl 4-[(4-cyclohexylphenyl)sulfonylamino]benzoate (PubChem CID 7938910) has the molecular formula C22H27NO4S and a molecular weight of 401.53 g/mol. Its IUPAC name is propan-2-yl 4-[(4-cyclohexylphenyl)sulfonylamino]benzoate.
| Compound Name | propan-2-yl 4-[(4-cyclohexylphenyl)sulfonylamino]benzoate |
|---|---|
| PubChem CID | 7938910 |
| Molecular Formula | C22H27NO4S |
| Molecular Weight | 401.53 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | propan-2-yl 4-[(4-cyclohexylphenyl)sulfonylamino]benzoate |
| SMILES | CC(C)OC(=O)c1ccc(NS(=O)(=O)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C22H27NO4S/c1-16(2)27-22(24)19-8-12-20(13-9-19)23-28(25,26)21-14-10-18(11-15-21)17-6-4-3-5-7-17/h8-17,23H,3-7H2,1-2H3 |
| InChIKey | VHHLQMHPYSHQGA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.53 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |