C24H28N2O4 — CID 8538390
[(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 4-cyclohexylbenzoate (PubChem CID 8538390) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 4-cyclohexylbenzoate.
| Compound Name | [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 4-cyclohexylbenzoate |
|---|---|
| PubChem CID | 8538390 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 4-cyclohexylbenzoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@@H](C)OC(=O)c2ccc(C3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C24H28N2O4/c1-16(23(28)26-22-14-12-21(13-15-22)25-17(2)27)30-24(29)20-10-8-19(9-11-20)18-6-4-3-5-7-18/h8-16,18H,3-7H2,1-2H3,(H,25,27)(H,26,28)/t16-/m1/s1 |
| InChIKey | XZSAXVBPCVVXIV-MRXNPFEDSA-N |
| XLogP | 4.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |