C23H27N3O4 — CID 7949863
[(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 4-acetamidobenzoate (PubChem CID 7949863) has the molecular formula C23H27N3O4 and a molecular weight of 409.49 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 4-acetamidobenzoate.
| Compound Name | [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 4-acetamidobenzoate |
|---|---|
| PubChem CID | 7949863 |
| Molecular Formula | C23H27N3O4 |
| Molecular Weight | 409.49 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 4-acetamidobenzoate |
| SMILES | CC(=O)Nc1ccc(C(=O)O[C@H](C)C(=O)Nc2ccc(N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C23H27N3O4/c1-16(30-23(29)18-6-8-19(9-7-18)24-17(2)27)22(28)25-20-10-12-21(13-11-20)26-14-4-3-5-15-26/h6-13,16H,3-5,14-15H2,1-2H3,(H,24,27)(H,25,28)/t16-/m1/s1 |
| InChIKey | RNUBYZZQZAZPRV-MRXNPFEDSA-N |
| XLogP | 3.82 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.49 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|