C24H25N3O4 — CID 7274885
[(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 4-(2,5-dimethylpyrrol-1-yl)benzoate (PubChem CID 7274885) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 4-(2,5-dimethylpyrrol-1-yl)benzoate.
| Compound Name | [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
|---|---|
| PubChem CID | 7274885 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | [(2R)-1-(4-acetamidoanilino)-1-oxopropan-2-yl] 4-(2,5-dimethylpyrrol-1-yl)benzoate |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@@H](C)OC(=O)c2ccc(-n3c(C)ccc3C)cc2)cc1 |
| InChI | InChI=1S/C24H25N3O4/c1-15-5-6-16(2)27(15)22-13-7-19(8-14-22)24(30)31-17(3)23(29)26-21-11-9-20(10-12-21)25-18(4)28/h5-14,17H,1-4H3,(H,25,28)(H,26,29)/t17-/m1/s1 |
| InChIKey | PCGNHZUIHWAJMY-QGZVFWFLSA-N |
| XLogP | 4.24 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|