C20H24N2O4 — CID 8968505
[(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-methylfuran-3-carboxylate (PubChem CID 8968505) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-methylfuran-3-carboxylate.
| Compound Name | [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 8968505 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-methylfuran-3-carboxylate |
| SMILES | Cc1occc1C(=O)O[C@H](C)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H24N2O4/c1-14-18(10-13-25-14)20(24)26-15(2)19(23)21-16-6-8-17(9-7-16)22-11-4-3-5-12-22/h6-10,13,15H,3-5,11-12H2,1-2H3,(H,21,23)/t15-/m1/s1 |
| InChIKey | VBWUYGLSFPZVPQ-OAHLLOKOSA-N |
| XLogP | 3.76 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|