C23H28N2O4 — CID 8606888
[(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-ethoxybenzoate (PubChem CID 8606888) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-ethoxybenzoate.
| Compound Name | [(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-ethoxybenzoate |
|---|---|
| PubChem CID | 8606888 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [(2S)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-ethoxybenzoate |
| SMILES | CCOc1ccccc1C(=O)O[C@@H](C)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C23H28N2O4/c1-3-28-21-10-6-5-9-20(21)23(27)29-17(2)22(26)24-18-11-13-19(14-12-18)25-15-7-4-8-16-25/h5-6,9-14,17H,3-4,7-8,15-16H2,1-2H3,(H,24,26)/t17-/m0/s1 |
| InChIKey | QJQGVRHFZKUHPF-KRWDZBQOSA-N |
| XLogP | 4.26 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|