C18H26N2O4 — CID 18286188
[1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-ethoxyacetate (PubChem CID 18286188) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is [1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-ethoxyacetate.
| Compound Name | [1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 18286188 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | [1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OC(C)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H26N2O4/c1-3-23-13-17(21)24-14(2)18(22)19-15-7-9-16(10-8-15)20-11-5-4-6-12-20/h7-10,14H,3-6,11-13H2,1-2H3,(H,19,22) |
| InChIKey | HWVNRBKRYGCXSM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|