C22H26N2O4S — CID 7781384
[(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 7781384) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7781384 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | [(2R)-1-oxo-1-(4-piperidin-1-ylanilino)propan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | C[C@@H](OC(=O)CCC(=O)c1cccs1)C(=O)Nc1ccc(N2CCCCC2)cc1 |
| InChI | InChI=1S/C22H26N2O4S/c1-16(28-21(26)12-11-19(25)20-6-5-15-29-20)22(27)23-17-7-9-18(10-8-17)24-13-3-2-4-14-24/h5-10,15-16H,2-4,11-14H2,1H3,(H,23,27)/t16-/m1/s1 |
| InChIKey | WECIYZZJXQQJMB-MRXNPFEDSA-N |
| XLogP | 4.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|