C18H18N2O5S — CID 7799888
[(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 7799888) has the molecular formula C18H18N2O5S and a molecular weight of 374.42 g/mol. Its IUPAC name is [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7799888 |
| Molecular Formula | C18H18N2O5S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [(2R)-1-(4-carbamoylanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | C[C@@H](OC(=O)CCC(=O)c1cccs1)C(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C18H18N2O5S/c1-11(18(24)20-13-6-4-12(5-7-13)17(19)23)25-16(22)9-8-14(21)15-3-2-10-26-15/h2-7,10-11H,8-9H2,1H3,(H2,19,23)(H,20,24)/t11-/m1/s1 |
| InChIKey | PLVJPAFLHLLXLU-LLVKDONJSA-N |
| XLogP | 2.38 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |