C17H16N2O6S — CID 7485340
[(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 7485340) has the molecular formula C17H16N2O6S and a molecular weight of 376.39 g/mol. Its IUPAC name is [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7485340 |
| Molecular Formula | C17H16N2O6S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | [(2R)-1-(2-nitroanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | C[C@@H](OC(=O)CCC(=O)c1cccs1)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H16N2O6S/c1-11(17(22)18-12-5-2-3-6-13(12)19(23)24)25-16(21)9-8-14(20)15-7-4-10-26-15/h2-7,10-11H,8-9H2,1H3,(H,18,22)/t11-/m1/s1 |
| InChIKey | XOONISWNQPOLLQ-LLVKDONJSA-N |
| XLogP | 3.19 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|