C18H19NO4S — CID 7799576
[(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 7799576) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7799576 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | [(2R)-1-(4-methylanilino)-1-oxopropan-2-yl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | Cc1ccc(NC(=O)[C@@H](C)OC(=O)CCC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C18H19NO4S/c1-12-5-7-14(8-6-12)19-18(22)13(2)23-17(21)10-9-15(20)16-4-3-11-24-16/h3-8,11,13H,9-10H2,1-2H3,(H,19,22)/t13-/m1/s1 |
| InChIKey | SFQGTCCXIGZMGP-CYBMUJFWSA-N |
| XLogP | 3.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |