C22H18FNO4S — CID 7799598
[(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 7799598) has the molecular formula C22H18FNO4S and a molecular weight of 411.45 g/mol. Its IUPAC name is [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7799598 |
| Molecular Formula | C22H18FNO4S |
| Molecular Weight | 411.45 g/mol |
| Exact Mass | 411.09 |
| IUPAC Name | [(1R)-2-(4-fluoroanilino)-2-oxo-1-phenylethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | O=C(CCC(=O)c1cccs1)O[C@@H](C(=O)Nc1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H18FNO4S/c23-16-8-10-17(11-9-16)24-22(27)21(15-5-2-1-3-6-15)28-20(26)13-12-18(25)19-7-4-14-29-19/h1-11,14,21H,12-13H2,(H,24,27)/t21-/m1/s1 |
| InChIKey | ZFYDUIGWBFQOIY-OAQYLSRUSA-N |
| XLogP | 4.77 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.45 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |