C23H24N2O6 — CID 46793320
[1-(2-nitroanilino)-1-oxopropan-2-yl] 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate (PubChem CID 46793320) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is [1-(2-nitroanilino)-1-oxopropan-2-yl] 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate.
| Compound Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate |
|---|---|
| PubChem CID | 46793320 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | [1-(2-nitroanilino)-1-oxopropan-2-yl] 4-oxo-4-(5,6,7,8-tetrahydronaphthalen-2-yl)butanoate |
| SMILES | CC(OC(=O)CCC(=O)c1ccc2c(c1)CCCC2)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H24N2O6/c1-15(23(28)24-19-8-4-5-9-20(19)25(29)30)31-22(27)13-12-21(26)18-11-10-16-6-2-3-7-17(16)14-18/h4-5,8-11,14-15H,2-3,6-7,12-13H2,1H3,(H,24,28) |
| InChIKey | GEJBQYRSCUKAGW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|