C16H14N2O6S — CID 5167185
[2-(2-nitroanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 5167185) has the molecular formula C16H14N2O6S and a molecular weight of 362.36 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 5167185 |
| Molecular Formula | C16H14N2O6S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.06 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1cccs1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H14N2O6S/c19-13(14-6-3-9-25-14)7-8-16(21)24-10-15(20)17-11-4-1-2-5-12(11)18(22)23/h1-6,9H,7-8,10H2,(H,17,20) |
| InChIKey | AATGUDIHSLEHQR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|