C14H12N2O5S — CID 35588003
[2-(4-methyl-2-nitroanilino)-2-oxoethyl] thiophene-2-carboxylate (PubChem CID 35588003) has the molecular formula C14H12N2O5S and a molecular weight of 320.33 g/mol. Its IUPAC name is [2-(4-methyl-2-nitroanilino)-2-oxoethyl] thiophene-2-carboxylate.
| Compound Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 35588003 |
| Molecular Formula | C14H12N2O5S |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | [2-(4-methyl-2-nitroanilino)-2-oxoethyl] thiophene-2-carboxylate |
| SMILES | Cc1ccc(NC(=O)COC(=O)c2cccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12N2O5S/c1-9-4-5-10(11(7-9)16(19)20)15-13(17)8-21-14(18)12-3-2-6-22-12/h2-7H,8H2,1H3,(H,15,17) |
| InChIKey | JBSRABRCWOLUQC-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|