C20H16N2O6S2 — CID 3407796
[2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 3407796) has the molecular formula C20H16N2O6S2 and a molecular weight of 444.49 g/mol. Its IUPAC name is [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 3407796 |
| Molecular Formula | C20H16N2O6S2 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.04 |
| IUPAC Name | [2-(4-methoxy-2-nitroanilino)-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | COc1ccc(NC(=O)COC(=O)C(=Cc2cccs2)c2cccs2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16N2O6S2/c1-27-13-6-7-16(17(10-13)22(25)26)21-19(23)12-28-20(24)15(18-5-3-9-30-18)11-14-4-2-8-29-14/h2-11H,12H2,1H3,(H,21,23) |
| InChIKey | OWFMFZBHAZRKOX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|