C19H13F2NO3S2 — CID 8819708
[2-(2,4-difluoroanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 8819708) has the molecular formula C19H13F2NO3S2 and a molecular weight of 405.45 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8819708 |
| Molecular Formula | C19H13F2NO3S2 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.03 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C(=C/c1cccs1)c1cccs1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H13F2NO3S2/c20-12-5-6-16(15(21)9-12)22-18(23)11-25-19(24)14(17-4-2-8-27-17)10-13-3-1-7-26-13/h1-10H,11H2,(H,22,23)/b14-10+ |
| InChIKey | ISSXLFOZHIOWPC-GXDHUFHOSA-N |
| XLogP | 4.81 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|