C20H15F2NO4S2 — CID 2390969
[2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 2390969) has the molecular formula C20H15F2NO4S2 and a molecular weight of 435.47 g/mol. Its IUPAC name is [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2390969 |
| Molecular Formula | C20H15F2NO4S2 |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.04 |
| IUPAC Name | [2-[2-(difluoromethoxy)anilino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C(=C/c1cccs1)c1cccs1)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C20H15F2NO4S2/c21-20(22)27-16-7-2-1-6-15(16)23-18(24)12-26-19(25)14(17-8-4-10-29-17)11-13-5-3-9-28-13/h1-11,20H,12H2,(H,23,24)/b14-11+ |
| InChIKey | QTDOCNXDWBQMKM-SDNWHVSQSA-N |
| XLogP | 5.13 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|