C21H17NO4S2 — CID 2089515
[2-(3-acetylanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 2089515) has the molecular formula C21H17NO4S2 and a molecular weight of 411.50 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2089515 |
| Molecular Formula | C21H17NO4S2 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | CC(=O)c1cccc(NC(=O)COC(=O)/C(=C/c2cccs2)c2cccs2)c1 |
| InChI | InChI=1S/C21H17NO4S2/c1-14(23)15-5-2-6-16(11-15)22-20(24)13-26-21(25)18(19-8-4-10-28-19)12-17-7-3-9-27-17/h2-12H,13H2,1H3,(H,22,24)/b18-12+ |
| InChIKey | IVXHATJKSPLIDL-LDADJPATSA-N |
| XLogP | 4.73 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|