C23H22N2O6S3 — CID 6530820
[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 6530820) has the molecular formula C23H22N2O6S3 and a molecular weight of 518.64 g/mol. Its IUPAC name is [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 6530820 |
| Molecular Formula | C23H22N2O6S3 |
| Molecular Weight | 518.64 g/mol |
| Exact Mass | 518.06 |
| IUPAC Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C(=C/c1cccs1)c1cccs1)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C23H22N2O6S3/c26-22(16-31-23(27)20(21-7-3-13-33-21)15-18-5-2-12-32-18)24-17-4-1-6-19(14-17)34(28,29)25-8-10-30-11-9-25/h1-7,12-15H,8-11,16H2,(H,24,26)/b20-15+ |
| InChIKey | CHOHDDJYXPSHFF-HMMYKYKNSA-N |
| XLogP | 3.55 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.64 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|