C20H22N2O6S2 — CID 3297690
[2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 3297690) has the molecular formula C20H22N2O6S2 and a molecular weight of 450.54 g/mol. Its IUPAC name is [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 3297690 |
| Molecular Formula | C20H22N2O6S2 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.09 |
| IUPAC Name | [2-oxo-2-(3-pyrrolidin-1-ylsulfonylanilino)ethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1cccs1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C20H22N2O6S2/c23-17(18-7-4-12-29-18)8-9-20(25)28-14-19(24)21-15-5-3-6-16(13-15)30(26,27)22-10-1-2-11-22/h3-7,12-13H,1-2,8-11,14H2,(H,21,24) |
| InChIKey | IZRRRPMDWOXHTJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |