C20H23NO5S2 — CID 7700197
(4-oxo-4-thiophen-2-ylbutyl) 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 7700197) has the molecular formula C20H23NO5S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is (4-oxo-4-thiophen-2-ylbutyl) 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | (4-oxo-4-thiophen-2-ylbutyl) 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7700197 |
| Molecular Formula | C20H23NO5S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | (4-oxo-4-thiophen-2-ylbutyl) 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCCCC(=O)c1cccs1)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C20H23NO5S2/c22-18(19-10-6-14-27-19)9-5-13-26-20(23)16-7-4-8-17(15-16)28(24,25)21-11-2-1-3-12-21/h4,6-8,10,14-15H,1-3,5,9,11-13H2 |
| InChIKey | QXBXBPMVHUHBQN-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|