C23H26FNO5S — CID 2545152
[4-(4-fluorophenyl)-4-oxobutyl] 3-(azepan-1-ylsulfonyl)benzoate (PubChem CID 2545152) has the molecular formula C23H26FNO5S and a molecular weight of 447.53 g/mol. Its IUPAC name is [4-(4-fluorophenyl)-4-oxobutyl] 3-(azepan-1-ylsulfonyl)benzoate.
| Compound Name | [4-(4-fluorophenyl)-4-oxobutyl] 3-(azepan-1-ylsulfonyl)benzoate |
|---|---|
| PubChem CID | 2545152 |
| Molecular Formula | C23H26FNO5S |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | [4-(4-fluorophenyl)-4-oxobutyl] 3-(azepan-1-ylsulfonyl)benzoate |
| SMILES | O=C(CCCOC(=O)c1cccc(S(=O)(=O)N2CCCCCC2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H26FNO5S/c24-20-12-10-18(11-13-20)22(26)9-6-16-30-23(27)19-7-5-8-21(17-19)31(28,29)25-14-3-1-2-4-15-25/h5,7-8,10-13,17H,1-4,6,9,14-16H2 |
| InChIKey | UQZWNMZIPIQZDK-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|