C19H21N3O6S2 — CID 16521918
[2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate (PubChem CID 16521918) has the molecular formula C19H21N3O6S2 and a molecular weight of 451.53 g/mol. Its IUPAC name is [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16521918 |
| Molecular Formula | C19H21N3O6S2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.09 |
| IUPAC Name | [2-[(3-carbamoylthiophen-2-yl)amino]-2-oxoethyl] 3-piperidin-1-ylsulfonylbenzoate |
| SMILES | NC(=O)c1ccsc1NC(=O)COC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1 |
| InChI | InChI=1S/C19H21N3O6S2/c20-17(24)15-7-10-29-18(15)21-16(23)12-28-19(25)13-5-4-6-14(11-13)30(26,27)22-8-2-1-3-9-22/h4-7,10-11H,1-3,8-9,12H2,(H2,20,24)(H,21,23) |
| InChIKey | DUIFZTKUHOZKRY-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 135.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |