C17H17NO4S2 — CID 7891018
[2-(3-methylsulfanylanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 7891018) has the molecular formula C17H17NO4S2 and a molecular weight of 363.46 g/mol. Its IUPAC name is [2-(3-methylsulfanylanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate.
| Compound Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate |
|---|---|
| PubChem CID | 7891018 |
| Molecular Formula | C17H17NO4S2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | [2-(3-methylsulfanylanilino)-2-oxoethyl] 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | CSc1cccc(NC(=O)COC(=O)CCC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C17H17NO4S2/c1-23-13-5-2-4-12(10-13)18-16(20)11-22-17(21)8-7-14(19)15-6-3-9-24-15/h2-6,9-10H,7-8,11H2,1H3,(H,18,20) |
| InChIKey | UUDMAEYAAOVKDC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |