C19H19NO6S — CID 2465519
ethyl 4-[[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]amino]benzoate (PubChem CID 2465519) has the molecular formula C19H19NO6S and a molecular weight of 389.43 g/mol. Its IUPAC name is ethyl 4-[[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]amino]benzoate |
|---|---|
| PubChem CID | 2465519 |
| Molecular Formula | C19H19NO6S |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.09 |
| IUPAC Name | ethyl 4-[[2-(4-oxo-4-thiophen-2-ylbutanoyl)oxyacetyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)COC(=O)CCC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C19H19NO6S/c1-2-25-19(24)13-5-7-14(8-6-13)20-17(22)12-26-18(23)10-9-15(21)16-4-3-11-27-16/h3-8,11H,2,9-10,12H2,1H3,(H,20,22) |
| InChIKey | RTUWUXPQIMZBFU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |