C15H16N2O2S — CID 8003499
ethyl 4-[(N-methyl-C-thiophen-2-ylcarbonimidoyl)amino]benzoate (PubChem CID 8003499) has the molecular formula C15H16N2O2S and a molecular weight of 288.37 g/mol. Its IUPAC name is ethyl 4-[(N-methyl-C-thiophen-2-ylcarbonimidoyl)amino]benzoate.
| Compound Name | ethyl 4-[(N-methyl-C-thiophen-2-ylcarbonimidoyl)amino]benzoate |
|---|---|
| PubChem CID | 8003499 |
| Molecular Formula | C15H16N2O2S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | ethyl 4-[(N-methyl-C-thiophen-2-ylcarbonimidoyl)amino]benzoate |
| SMILES | CCOC(=O)c1ccc(N/C(=N/C)c2cccs2)cc1 |
| InChI | InChI=1S/C15H16N2O2S/c1-3-19-15(18)11-6-8-12(9-7-11)17-14(16-2)13-5-4-10-20-13/h4-10H,3H2,1-2H3,(H,16,17) |
| InChIKey | GQPYJNJBCOFXLF-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|