C26H24N2O6S — CID 2892447
ethyl 4-[[2-[(4-ethoxycarbonylphenyl)carbamoyl]-3-thiophen-2-ylprop-2-enoyl]amino]benzoate (PubChem CID 2892447) has the molecular formula C26H24N2O6S and a molecular weight of 492.55 g/mol. Its IUPAC name is ethyl 4-[[2-[(4-ethoxycarbonylphenyl)carbamoyl]-3-thiophen-2-ylprop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-[(4-ethoxycarbonylphenyl)carbamoyl]-3-thiophen-2-ylprop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 2892447 |
| Molecular Formula | C26H24N2O6S |
| Molecular Weight | 492.55 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | ethyl 4-[[2-[(4-ethoxycarbonylphenyl)carbamoyl]-3-thiophen-2-ylprop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)C(=Cc2cccs2)C(=O)Nc2ccc(C(=O)OCC)cc2)cc1 |
| InChI | InChI=1S/C26H24N2O6S/c1-3-33-25(31)17-7-11-19(12-8-17)27-23(29)22(16-21-6-5-15-35-21)24(30)28-20-13-9-18(10-14-20)26(32)34-4-2/h5-16H,3-4H2,1-2H3,(H,27,29)(H,28,30) |
| InChIKey | XPSABHYCVPMSCP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.55 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|