C18H19ClN2O4S2 — CID 17427305
4-(5-chlorothiophen-2-yl)-4-oxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide (PubChem CID 17427305) has the molecular formula C18H19ClN2O4S2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 4-(5-chlorothiophen-2-yl)-4-oxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide.
| Compound Name | 4-(5-chlorothiophen-2-yl)-4-oxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 17427305 |
| Molecular Formula | C18H19ClN2O4S2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.05 |
| IUPAC Name | 4-(5-chlorothiophen-2-yl)-4-oxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)s1)Nc1cccc(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C18H19ClN2O4S2/c19-17-8-7-16(26-17)15(22)6-9-18(23)20-13-4-3-5-14(12-13)27(24,25)21-10-1-2-11-21/h3-5,7-8,12H,1-2,6,9-11H2,(H,20,23) |
| InChIKey | OQVACUXQQLIERZ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |