C22H26N2O4S — CID 9415015
4-(2,5-dimethylphenyl)-4-oxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide (PubChem CID 9415015) has the molecular formula C22H26N2O4S and a molecular weight of 414.53 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-4-oxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide.
| Compound Name | 4-(2,5-dimethylphenyl)-4-oxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide |
|---|---|
| PubChem CID | 9415015 |
| Molecular Formula | C22H26N2O4S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-4-oxo-N-(3-pyrrolidin-1-ylsulfonylphenyl)butanamide |
| SMILES | Cc1ccc(C)c(C(=O)CCC(=O)Nc2cccc(S(=O)(=O)N3CCCC3)c2)c1 |
| InChI | InChI=1S/C22H26N2O4S/c1-16-8-9-17(2)20(14-16)21(25)10-11-22(26)23-18-6-5-7-19(15-18)29(27,28)24-12-3-4-13-24/h5-9,14-15H,3-4,10-13H2,1-2H3,(H,23,26) |
| InChIKey | HTYPMIFJBRBURE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |