C20H15NO5S2 — CID 6515277
[2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 6515277) has the molecular formula C20H15NO5S2 and a molecular weight of 413.48 g/mol. Its IUPAC name is [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 6515277 |
| Molecular Formula | C20H15NO5S2 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | [2-(1,3-benzodioxol-5-ylamino)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C(=C/c1cccs1)c1cccs1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H15NO5S2/c22-19(21-13-5-6-16-17(9-13)26-12-25-16)11-24-20(23)15(18-4-2-8-28-18)10-14-3-1-7-27-14/h1-10H,11-12H2,(H,21,22)/b15-10+ |
| InChIKey | DRHWPDMOARHUPB-XNTDXEJSSA-N |
| XLogP | 4.26 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|