C18H13ClN2O3S2 — CID 8819248
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 8819248) has the molecular formula C18H13ClN2O3S2 and a molecular weight of 404.90 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8819248 |
| Molecular Formula | C18H13ClN2O3S2 |
| Molecular Weight | 404.90 g/mol |
| Exact Mass | 404.01 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | O=C(COC(=O)/C(=C/c1cccs1)c1cccs1)Nc1cccnc1Cl |
| InChI | InChI=1S/C18H13ClN2O3S2/c19-17-14(5-1-7-20-17)21-16(22)11-24-18(23)13(15-6-3-9-26-15)10-12-4-2-8-25-12/h1-10H,11H2,(H,21,22)/b13-10+ |
| InChIKey | GLGFFSDQBPROQL-JLHYYAGUSA-N |
| XLogP | 4.58 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.90 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|