C19H13FO3S2 — CID 3505417
[2-(2-fluorophenyl)-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 3505417) has the molecular formula C19H13FO3S2 and a molecular weight of 372.44 g/mol. Its IUPAC name is [2-(2-fluorophenyl)-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(2-fluorophenyl)-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 3505417 |
| Molecular Formula | C19H13FO3S2 |
| Molecular Weight | 372.44 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | [2-(2-fluorophenyl)-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | O=C(OCC(=O)c1ccccc1F)C(=Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C19H13FO3S2/c20-16-7-2-1-6-14(16)17(21)12-23-19(22)15(18-8-4-10-25-18)11-13-5-3-9-24-13/h1-11H,12H2 |
| InChIKey | PVTMRPDZXGBZBU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.44 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|