C21H18O4S2 — CID 8023779
[2-(4-ethoxyphenyl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 8023779) has the molecular formula C21H18O4S2 and a molecular weight of 398.51 g/mol. Its IUPAC name is [2-(4-ethoxyphenyl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-(4-ethoxyphenyl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 8023779 |
| Molecular Formula | C21H18O4S2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.06 |
| IUPAC Name | [2-(4-ethoxyphenyl)-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | CCOc1ccc(C(=O)COC(=O)/C(=C/c2cccs2)c2cccs2)cc1 |
| InChI | InChI=1S/C21H18O4S2/c1-2-24-16-9-7-15(8-10-16)19(22)14-25-21(23)18(20-6-4-12-27-20)13-17-5-3-11-26-17/h3-13H,2,14H2,1H3/b18-13+ |
| InChIKey | SOFNUOBVSVBCNV-QGOAFFKASA-N |
| XLogP | 5.18 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|