C20H23NO3S2 — CID 7416869
[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 7416869) has the molecular formula C20H23NO3S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is [2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 7416869 |
| Molecular Formula | C20H23NO3S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | [2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl] (Z)-2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)COC(=O)/C(=C/c1cccs1)c1cccs1 |
| InChI | InChI=1S/C20H23NO3S2/c1-14-6-3-7-15(2)21(14)19(22)13-24-20(23)17(18-9-5-11-26-18)12-16-8-4-10-25-16/h4-5,8-12,14-15H,3,6-7,13H2,1-2H3/b17-12+/t14-,15-/m0/s1 |
| InChIKey | NABLBEMGTMXSAR-USUVONOQSA-N |
| XLogP | 4.68 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|