C17H16N2O3S2 — CID 4544599
[2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate (PubChem CID 4544599) has the molecular formula C17H16N2O3S2 and a molecular weight of 360.46 g/mol. Its IUPAC name is [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate.
| Compound Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 4544599 |
| Molecular Formula | C17H16N2O3S2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | [2-[2-cyanoethyl(methyl)amino]-2-oxoethyl] 2,3-dithiophen-2-ylprop-2-enoate |
| SMILES | CN(CCC#N)C(=O)COC(=O)C(=Cc1cccs1)c1cccs1 |
| InChI | InChI=1S/C17H16N2O3S2/c1-19(8-4-7-18)16(20)12-22-17(21)14(15-6-3-10-24-15)11-13-5-2-9-23-13/h2-3,5-6,9-11H,4,8,12H2,1H3 |
| InChIKey | WMHJDISEUZIHPB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|