C24H19FN2O3S — CID 2431516
[2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] (Z)-3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate (PubChem CID 2431516) has the molecular formula C24H19FN2O3S and a molecular weight of 434.49 g/mol. Its IUPAC name is [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] (Z)-3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] (Z)-3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 2431516 |
| Molecular Formula | C24H19FN2O3S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | [2-[N-(2-cyanoethyl)anilino]-2-oxoethyl] (Z)-3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate |
| SMILES | N#CCCN(C(=O)COC(=O)/C(=C/c1ccc(F)cc1)c1cccs1)c1ccccc1 |
| InChI | InChI=1S/C24H19FN2O3S/c25-19-11-9-18(10-12-19)16-21(22-8-4-15-31-22)24(29)30-17-23(28)27(14-5-13-26)20-6-2-1-3-7-20/h1-4,6-12,15-16H,5,14,17H2/b21-16+ |
| InChIKey | XPADRKWFPKRWFN-LTGZKZEYSA-N |
| XLogP | 4.92 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|