C24H21FN2O4S — CID 29407018
[2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate (PubChem CID 29407018) has the molecular formula C24H21FN2O4S and a molecular weight of 452.51 g/mol. Its IUPAC name is [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate.
| Compound Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 29407018 |
| Molecular Formula | C24H21FN2O4S |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [2-[4-(dimethylcarbamoyl)anilino]-2-oxoethyl] 3-(4-fluorophenyl)-2-thiophen-2-ylprop-2-enoate |
| SMILES | CN(C)C(=O)c1ccc(NC(=O)COC(=O)C(=Cc2ccc(F)cc2)c2cccs2)cc1 |
| InChI | InChI=1S/C24H21FN2O4S/c1-27(2)23(29)17-7-11-19(12-8-17)26-22(28)15-31-24(30)20(21-4-3-13-32-21)14-16-5-9-18(25)10-6-16/h3-14H,15H2,1-2H3,(H,26,28) |
| InChIKey | MXYMNJNEUBYSKY-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|